C30H42O7 — CID 70610322
2-[(1S,2S,3S,5R)-2-[4-(2,3-dihydro-1H-inden-2-yl)-1-(oxan-2-yloxy)but-1-enyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]acetic acid (PubChem CID 70610322) has the molecular formula C30H42O7 and a molecular weight of 514.66 g/mol. Its IUPAC name is 2-[(1S,2S,3S,5R)-2-[4-(2,3-dihydro-1H-inden-2-yl)-1-(oxan-2-yloxy)but-1-enyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]acetic acid.
| Compound Name | 2-[(1S,2S,3S,5R)-2-[4-(2,3-dihydro-1H-inden-2-yl)-1-(oxan-2-yloxy)but-1-enyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 70610322 |
| Molecular Formula | C30H42O7 |
| Molecular Weight | 514.66 g/mol |
| Exact Mass | 514.29 |
| IUPAC Name | 2-[(1S,2S,3S,5R)-2-[4-(2,3-dihydro-1H-inden-2-yl)-1-(oxan-2-yloxy)but-1-enyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]acetic acid |
| SMILES | O=C(O)C[C@H]1[C@H](C(=CCCC2Cc3ccccc3C2)OC2CCCCO2)[C@@H](OC2CCCCO2)C[C@H]1O |
| InChI | InChI=1S/C30H42O7/c31-24-19-26(37-29-13-4-6-15-35-29)30(23(24)18-27(32)33)25(36-28-12-3-5-14-34-28)11-7-8-20-16-21-9-1-2-10-22(21)17-20/h1-2,9-11,20,23-24,26,28-31H,3-8,12-19H2,(H,32,33)/t23-,24-,26+,28?,29?,30-/m1/s1 |
| InChIKey | CXEWETJILOIISF-RGPBYHMJSA-N |
| XLogP | 4.99 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.66 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|