C28H38O8 — CID 67931768
(3aS,4S,5R,6aR)-4-[(E)-4-(4-methoxyphenoxy)-1-(oxan-2-yloxy)but-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 67931768) has the molecular formula C28H38O8 and a molecular weight of 502.60 g/mol. Its IUPAC name is (3aS,4S,5R,6aR)-4-[(E)-4-(4-methoxyphenoxy)-1-(oxan-2-yloxy)but-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aS,4S,5R,6aR)-4-[(E)-4-(4-methoxyphenoxy)-1-(oxan-2-yloxy)but-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 67931768 |
| Molecular Formula | C28H38O8 |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | (3aS,4S,5R,6aR)-4-[(E)-4-(4-methoxyphenoxy)-1-(oxan-2-yloxy)but-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | COc1ccc(OCC/C=C(/OC2CCCCO2)[C@H]2[C@@H]3CC(=O)O[C@@H]3C[C@H]2OC2CCCCO2)cc1 |
| InChI | InChI=1S/C28H38O8/c1-30-19-10-12-20(13-11-19)31-16-6-7-22(35-26-8-2-4-14-32-26)28-21-17-25(29)34-23(21)18-24(28)36-27-9-3-5-15-33-27/h7,10-13,21,23-24,26-28H,2-6,8-9,14-18H2,1H3/b22-7+/t21-,23-,24-,26?,27?,28-/m1/s1 |
| InChIKey | IHQJFMWKSIGWOQ-QGTBFEQHSA-N |
| XLogP | 4.75 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|