C16H25NO5 — CID 70579357
(3aR,5S,6aS)-4-morpholin-4-yl-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 70579357) has the molecular formula C16H25NO5 and a molecular weight of 311.38 g/mol. Its IUPAC name is (3aR,5S,6aS)-4-morpholin-4-yl-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,5S,6aS)-4-morpholin-4-yl-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 70579357 |
| Molecular Formula | C16H25NO5 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | (3aR,5S,6aS)-4-morpholin-4-yl-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | O=C1C[C@@H]2C(N3CCOCC3)[C@@H](OC3CCCCO3)C[C@@H]2O1 |
| InChI | InChI=1S/C16H25NO5/c18-14-9-11-12(21-14)10-13(22-15-3-1-2-6-20-15)16(11)17-4-7-19-8-5-17/h11-13,15-16H,1-10H2/t11-,12-,13-,15?,16?/m0/s1 |
| InChIKey | XMNNJRJNMFBJPQ-SZOBRSDKSA-N |
| XLogP | 0.93 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |