C17H31NO4Si — CID 22815893
(3aS,4R,5R,6aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-morpholin-4-yl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 22815893) has the molecular formula C17H31NO4Si and a molecular weight of 341.52 g/mol. Its IUPAC name is (3aS,4R,5R,6aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-morpholin-4-yl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aS,4R,5R,6aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-morpholin-4-yl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 22815893 |
| Molecular Formula | C17H31NO4Si |
| Molecular Weight | 341.52 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | (3aS,4R,5R,6aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-morpholin-4-yl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@H]2OC(=O)C[C@H]2[C@H]1N1CCOCC1 |
| InChI | InChI=1S/C17H31NO4Si/c1-17(2,3)23(4,5)22-14-11-13-12(10-15(19)21-13)16(14)18-6-8-20-9-7-18/h12-14,16H,6-11H2,1-5H3/t12-,13-,14-,16-/m1/s1 |
| InChIKey | VJDZLWGNTNDNGS-IXYNUQLISA-N |
| XLogP | 2.41 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.52 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|