C19H25NO5 — CID 12786304
6-[(4-methoxyphenyl)methoxy]-8-morpholin-4-yl-2-oxabicyclo[3.2.1]octan-3-one (PubChem CID 12786304) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is 6-[(4-methoxyphenyl)methoxy]-8-morpholin-4-yl-2-oxabicyclo[3.2.1]octan-3-one.
| Compound Name | 6-[(4-methoxyphenyl)methoxy]-8-morpholin-4-yl-2-oxabicyclo[3.2.1]octan-3-one |
|---|---|
| PubChem CID | 12786304 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 6-[(4-methoxyphenyl)methoxy]-8-morpholin-4-yl-2-oxabicyclo[3.2.1]octan-3-one |
| SMILES | COc1ccc(COC2CC3OC(=O)CC2C3N2CCOCC2)cc1 |
| InChI | InChI=1S/C19H25NO5/c1-22-14-4-2-13(3-5-14)12-24-16-11-17-19(15(16)10-18(21)25-17)20-6-8-23-9-7-20/h2-5,15-17,19H,6-12H2,1H3 |
| InChIKey | AAAQNCZACMCKFC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |