C19H29NO5 — CID 88753284
acetaldehyde;(1S,2S,4S)-4-[(4-methoxyphenyl)methoxy]-2-morpholin-4-ylcyclopentan-1-ol (PubChem CID 88753284) has the molecular formula C19H29NO5 and a molecular weight of 351.44 g/mol. Its IUPAC name is acetaldehyde;(1S,2S,4S)-4-[(4-methoxyphenyl)methoxy]-2-morpholin-4-ylcyclopentan-1-ol.
| Compound Name | acetaldehyde;(1S,2S,4S)-4-[(4-methoxyphenyl)methoxy]-2-morpholin-4-ylcyclopentan-1-ol |
|---|---|
| PubChem CID | 88753284 |
| Molecular Formula | C19H29NO5 |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | acetaldehyde;(1S,2S,4S)-4-[(4-methoxyphenyl)methoxy]-2-morpholin-4-ylcyclopentan-1-ol |
| SMILES | CC=O.COc1ccc(CO[C@@H]2C[C@H](O)[C@@H](N3CCOCC3)C2)cc1 |
| InChI | InChI=1S/C17H25NO4.C2H4O/c1-20-14-4-2-13(3-5-14)12-22-15-10-16(17(19)11-15)18-6-8-21-9-7-18;1-2-3/h2-5,15-17,19H,6-12H2,1H3;2H,1H3/t15-,16-,17-;/m0./s1 |
| InChIKey | CJAXWJIOMZWDNB-FRKSIBALSA-N |
| XLogP | 1.64 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|