C24H29FO7 — CID 22803353
(3aR,4R,5R,6aS)-4-[(E)-2-[2-[(4-fluorophenoxy)methyl]-1,3-dioxolan-2-yl]ethenyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 22803353) has the molecular formula C24H29FO7 and a molecular weight of 448.49 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-[(E)-2-[2-[(4-fluorophenoxy)methyl]-1,3-dioxolan-2-yl]ethenyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,5R,6aS)-4-[(E)-2-[2-[(4-fluorophenoxy)methyl]-1,3-dioxolan-2-yl]ethenyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 22803353 |
| Molecular Formula | C24H29FO7 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-[(E)-2-[2-[(4-fluorophenoxy)methyl]-1,3-dioxolan-2-yl]ethenyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | O=C1C[C@@H]2[C@@H](/C=C/C3(COc4ccc(F)cc4)OCCO3)[C@H](OC3CCCCO3)C[C@@H]2O1 |
| InChI | InChI=1S/C24H29FO7/c25-16-4-6-17(7-5-16)28-15-24(29-11-12-30-24)9-8-18-19-13-22(26)31-21(19)14-20(18)32-23-3-1-2-10-27-23/h4-9,18-21,23H,1-3,10-15H2/b9-8+/t18-,19-,20-,21+,23?/m1/s1 |
| InChIKey | QZCKBYYIRAJIAW-XQIFHXNVSA-N |
| XLogP | 3.37 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|