C23H24O6 — CID 15199841
(3aR,4R,5R,6aS)-5-hydroxy-4-[(E)-2-[2-(naphthalen-2-yloxymethyl)-1,3-dioxolan-2-yl]ethenyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 15199841) has the molecular formula C23H24O6 and a molecular weight of 396.44 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-5-hydroxy-4-[(E)-2-[2-(naphthalen-2-yloxymethyl)-1,3-dioxolan-2-yl]ethenyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,5R,6aS)-5-hydroxy-4-[(E)-2-[2-(naphthalen-2-yloxymethyl)-1,3-dioxolan-2-yl]ethenyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 15199841 |
| Molecular Formula | C23H24O6 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | (3aR,4R,5R,6aS)-5-hydroxy-4-[(E)-2-[2-(naphthalen-2-yloxymethyl)-1,3-dioxolan-2-yl]ethenyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | O=C1C[C@@H]2[C@@H](/C=C/C3(COc4ccc5ccccc5c4)OCCO3)[C@H](O)C[C@@H]2O1 |
| InChI | InChI=1S/C23H24O6/c24-20-13-21-19(12-22(25)29-21)18(20)7-8-23(27-9-10-28-23)14-26-17-6-5-15-3-1-2-4-16(15)11-17/h1-8,11,18-21,24H,9-10,12-14H2/b8-7+/t18-,19-,20-,21+/m1/s1 |
| InChIKey | BKNKBTDFASJMBC-WGDIWWLSSA-N |
| XLogP | 2.83 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|