C42H62O9SSi — CID 88605028
butyl-[(1R,2S,3S,4S)-2-but-3-ynyl-4-(oxan-2-yloxy)-3-[(E)-1-(oxan-2-yloxy)-4-phenoxybut-1-enyl]cyclopentyl]oxy-dimethylsilane;2-methylbenzenesulfonic acid (PubChem CID 88605028) has the molecular formula C42H62O9SSi and a molecular weight of 771.10 g/mol. Its IUPAC name is butyl-[(1R,2S,3S,4S)-2-but-3-ynyl-4-(oxan-2-yloxy)-3-[(E)-1-(oxan-2-yloxy)-4-phenoxybut-1-enyl]cyclopentyl]oxy-dimethylsilane;2-methylbenzenesulfonic acid.
| Compound Name | butyl-[(1R,2S,3S,4S)-2-but-3-ynyl-4-(oxan-2-yloxy)-3-[(E)-1-(oxan-2-yloxy)-4-phenoxybut-1-enyl]cyclopentyl]oxy-dimethylsilane;2-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 88605028 |
| Molecular Formula | C42H62O9SSi |
| Molecular Weight | 771.10 g/mol |
| Exact Mass | 770.39 |
| IUPAC Name | butyl-[(1R,2S,3S,4S)-2-but-3-ynyl-4-(oxan-2-yloxy)-3-[(E)-1-(oxan-2-yloxy)-4-phenoxybut-1-enyl]cyclopentyl]oxy-dimethylsilane;2-methylbenzenesulfonic acid |
| SMILES | C#CCC[C@H]1[C@H](/C(=C\CCOc2ccccc2)OC2CCCCO2)[C@@H](OC2CCCCO2)C[C@H]1O[Si](C)(C)CCCC.Cc1ccccc1S(=O)(=O)O |
| InChI | InChI=1S/C35H54O6Si.C7H8O3S/c1-5-7-19-29-31(41-42(3,4)26-8-6-2)27-32(40-34-22-13-15-24-38-34)35(29)30(39-33-21-12-14-23-37-33)20-16-25-36-28-17-10-9-11-18-28;1-6-4-2-3-5-7(6)11(8,9)10/h1,9-11,17-18,20,29,31-35H,6-8,12-16,19,21-27H2,2-4H3;2-5H,1H3,(H,8,9,10)/b30-20+;/t29-,31-,32+,33?,34?,35-;/m1./s1 |
| InChIKey | OFOLBHNLOLGOGE-YLANIALASA-N |
| XLogP | 9.48 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.10 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|