C26H46O7S — CID 70624262
2-[(2R,3S,4S)-3-[4,4-dimethyl-1-(oxan-2-yloxy)oct-1-enyl]-4-(oxan-2-yloxy)-1,1-dioxothiolan-2-yl]ethanol (PubChem CID 70624262) has the molecular formula C26H46O7S and a molecular weight of 502.71 g/mol. Its IUPAC name is 2-[(2R,3S,4S)-3-[4,4-dimethyl-1-(oxan-2-yloxy)oct-1-enyl]-4-(oxan-2-yloxy)-1,1-dioxothiolan-2-yl]ethanol.
| Compound Name | 2-[(2R,3S,4S)-3-[4,4-dimethyl-1-(oxan-2-yloxy)oct-1-enyl]-4-(oxan-2-yloxy)-1,1-dioxothiolan-2-yl]ethanol |
|---|---|
| PubChem CID | 70624262 |
| Molecular Formula | C26H46O7S |
| Molecular Weight | 502.71 g/mol |
| Exact Mass | 502.30 |
| IUPAC Name | 2-[(2R,3S,4S)-3-[4,4-dimethyl-1-(oxan-2-yloxy)oct-1-enyl]-4-(oxan-2-yloxy)-1,1-dioxothiolan-2-yl]ethanol |
| SMILES | CCCCC(C)(C)CC=C(OC1CCCCO1)[C@H]1[C@@H](CCO)S(=O)(=O)C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C26H46O7S/c1-4-5-14-26(2,3)15-12-20(32-23-10-6-8-17-30-23)25-21(33-24-11-7-9-18-31-24)19-34(28,29)22(25)13-16-27/h12,21-25,27H,4-11,13-19H2,1-3H3/t21-,22-,23?,24?,25-/m1/s1 |
| InChIKey | VBYDIJYTISLPFL-JDPIBSFWSA-N |
| XLogP | 4.73 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.71 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|