About (Z)-heptadec-11-en-1-ol;2-(oxan-2-yloxy)oxane
(Z)-heptadec-11-en-1-ol;2-(oxan-2-yloxy)oxane (PubChem CID 86737423) has the molecular formula C27H52O4
and a molecular weight of 440.71 g/mol. Its IUPAC name is (Z)-heptadec-11-en-1-ol;2-(oxan-2-yloxy)oxane.
Molecular Properties
| Compound Name | (Z)-heptadec-11-en-1-ol;2-(oxan-2-yloxy)oxane |
| PubChem CID | 86737423 |
| Molecular Formula | C27H52O4 |
| Molecular Weight | 440.71 g/mol |
| Exact Mass | 440.39 |
| IUPAC Name | (Z)-heptadec-11-en-1-ol;2-(oxan-2-yloxy)oxane |
| SMILES | C1CCC(OC2CCCCO2)OC1.CCCCC/C=C\CCCCCCCCCCO |
| InChI | InChI=1S/C17H34O.C10H18O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18;1-3-7-11-9(5-1)13-10-6-2-4-8-12-10/h6-7,18H,2-5,8-17H2,1H3;9-10H,1-8H2/b7-6-; |
| InChIKey | ZSOIFYQUMGOEMU-NAFXZHHSSA-N |
| XLogP | 7.68 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.71 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-heptadec-11-en-1-ol;2-(oxan-2-yloxy)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-heptadec-11-en-1-ol;2-(oxan-2-yloxy)oxane?
The IUPAC name of (Z)-heptadec-11-en-1-ol;2-(oxan-2-yloxy)oxane (CID 86737423) is (Z)-heptadec-11-en-1-ol;2-(oxan-2-yloxy)oxane.
What is the SMILES notation for (Z)-heptadec-11-en-1-ol;2-(oxan-2-yloxy)oxane?
The canonical SMILES for (Z)-heptadec-11-en-1-ol;2-(oxan-2-yloxy)oxane is C1CCC(OC2CCCCO2)OC1.CCCCC/C=C\CCCCCCCCCCO.
What is the InChIKey of (Z)-heptadec-11-en-1-ol;2-(oxan-2-yloxy)oxane?
The InChIKey is ZSOIFYQUMGOEMU-NAFXZHHSSA-N. The full InChI is InChI=1S/C17H34O.C10H18O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18;1-3-7-11-9(5-1)13-10-6-2-4-8-12-10/h6-7,18H,2-5,8-17H2,1H3;9-10H,1-8H2/b7-6-;.
What are the key properties of (Z)-heptadec-11-en-1-ol;2-(oxan-2-yloxy)oxane?
(Z)-heptadec-11-en-1-ol;2-(oxan-2-yloxy)oxane has a molecular weight of 440.71 g/mol, XLogP of 7.68, 16 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-heptadec-11-en-1-ol;2-(oxan-2-yloxy)oxane is sourced from PubChem (CID 86737423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).