C24H46O4 — CID 70507744
2,2-dimethyldodec-3-en-1-ol;2-(oxan-2-yloxy)oxane (PubChem CID 70507744) has the molecular formula C24H46O4 and a molecular weight of 398.63 g/mol. Its IUPAC name is 2,2-dimethyldodec-3-en-1-ol;2-(oxan-2-yloxy)oxane.
| Compound Name | 2,2-dimethyldodec-3-en-1-ol;2-(oxan-2-yloxy)oxane |
|---|---|
| PubChem CID | 70507744 |
| Molecular Formula | C24H46O4 |
| Molecular Weight | 398.63 g/mol |
| Exact Mass | 398.34 |
| IUPAC Name | 2,2-dimethyldodec-3-en-1-ol;2-(oxan-2-yloxy)oxane |
| SMILES | C1CCC(OC2CCCCO2)OC1.CCCCCCCCC=CC(C)(C)CO |
| InChI | InChI=1S/C14H28O.C10H18O3/c1-4-5-6-7-8-9-10-11-12-14(2,3)13-15;1-3-7-11-9(5-1)13-10-6-2-4-8-12-10/h11-12,15H,4-10,13H2,1-3H3;9-10H,1-8H2 |
| InChIKey | XYVWDIAHAGGWPX-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.63 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|