C18H32O2 — CID 125486039
(2S)-2-[(5Z,9Z)-trideca-5,9-dienoxy]oxane (PubChem CID 125486039) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is (2S)-2-[(5Z,9Z)-trideca-5,9-dienoxy]oxane.
| Compound Name | (2S)-2-[(5Z,9Z)-trideca-5,9-dienoxy]oxane |
|---|---|
| PubChem CID | 125486039 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | (2S)-2-[(5Z,9Z)-trideca-5,9-dienoxy]oxane |
| SMILES | CCC/C=C\CC/C=C\CCCCO[C@H]1CCCCO1 |
| InChI | InChI=1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-13-16-19-18-15-12-14-17-20-18/h4-5,8-9,18H,2-3,6-7,10-17H2,1H3/b5-4-,9-8-/t18-/m1/s1 |
| InChIKey | JMPMPVAWJBSHRS-WYVKJRNPSA-N |
| XLogP | 5.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|