C17H30O2 — CID 6450274
(2R)-2-[(8E,10E)-dodeca-8,10-dienoxy]oxane (PubChem CID 6450274) has the molecular formula C17H30O2 and a molecular weight of 266.42 g/mol. Its IUPAC name is (2R)-2-[(8E,10E)-dodeca-8,10-dienoxy]oxane.
| Compound Name | (2R)-2-[(8E,10E)-dodeca-8,10-dienoxy]oxane |
|---|---|
| PubChem CID | 6450274 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | (2R)-2-[(8E,10E)-dodeca-8,10-dienoxy]oxane |
| SMILES | C/C=C/C=C/CCCCCCCO[C@@H]1CCCCO1 |
| InChI | InChI=1S/C17H30O2/c1-2-3-4-5-6-7-8-9-10-12-15-18-17-14-11-13-16-19-17/h2-5,17H,6-16H2,1H3/b3-2+,5-4+/t17-/m0/s1 |
| InChIKey | PDBJRNWOKYKKQY-YWFLOKTBSA-N |
| XLogP | 5.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|