C35H60O7 — CID 57099136
7-[(1R,2R,3R,5S)-3,5-bis(oxan-2-yloxy)-2-[(3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]hept-5-en-1-ol (PubChem CID 57099136) has the molecular formula C35H60O7 and a molecular weight of 592.86 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-3,5-bis(oxan-2-yloxy)-2-[(3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]hept-5-en-1-ol.
| Compound Name | 7-[(1R,2R,3R,5S)-3,5-bis(oxan-2-yloxy)-2-[(3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]hept-5-en-1-ol |
|---|---|
| PubChem CID | 57099136 |
| Molecular Formula | C35H60O7 |
| Molecular Weight | 592.86 g/mol |
| Exact Mass | 592.43 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-3,5-bis(oxan-2-yloxy)-2-[(3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]hept-5-en-1-ol |
| SMILES | CCCCC[C@@H](C=C[C@@H]1[C@@H](CC=CCCCCO)[C@@H](OC2CCCCO2)C[C@H]1OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C35H60O7/c1-2-3-7-16-28(40-33-18-9-13-24-37-33)21-22-30-29(17-8-5-4-6-12-23-36)31(41-34-19-10-14-25-38-34)27-32(30)42-35-20-11-15-26-39-35/h5,8,21-22,28-36H,2-4,6-7,9-20,23-27H2,1H3/t28-,29+,30+,31-,32+,33?,34?,35?/m0/s1 |
| InChIKey | FGRSCBKMDWMDIJ-SRAACZIUSA-N |
| XLogP | 7.60 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.86 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|