C37H60O9 — CID 15518070
[(Z)-7-[(1R,2R,3R,5S)-3,5-bis(oxan-2-yloxy)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]-2-oxohept-5-enyl] acetate (PubChem CID 15518070) has the molecular formula C37H60O9 and a molecular weight of 648.88 g/mol. Its IUPAC name is [(Z)-7-[(1R,2R,3R,5S)-3,5-bis(oxan-2-yloxy)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]-2-oxohept-5-enyl] acetate.
| Compound Name | [(Z)-7-[(1R,2R,3R,5S)-3,5-bis(oxan-2-yloxy)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]-2-oxohept-5-enyl] acetate |
|---|---|
| PubChem CID | 15518070 |
| Molecular Formula | C37H60O9 |
| Molecular Weight | 648.88 g/mol |
| Exact Mass | 648.42 |
| IUPAC Name | [(Z)-7-[(1R,2R,3R,5S)-3,5-bis(oxan-2-yloxy)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]-2-oxohept-5-enyl] acetate |
| SMILES | CCCCC[C@@H](/C=C/[C@@H]1[C@@H](C/C=C\CCC(=O)COC(C)=O)[C@@H](OC2CCCCO2)C[C@H]1OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C37H60O9/c1-3-4-6-16-30(44-35-18-9-12-23-40-35)21-22-32-31(17-8-5-7-15-29(39)27-43-28(2)38)33(45-36-19-10-13-24-41-36)26-34(32)46-37-20-11-14-25-42-37/h5,8,21-22,30-37H,3-4,6-7,9-20,23-27H2,1-2H3/b8-5-,22-21+/t30-,31+,32+,33-,34+,35?,36?,37?/m0/s1 |
| InChIKey | BFICIAJGASVMRR-HMYORQLISA-N |
| XLogP | 7.35 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.88 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|