C40H61NO7 — CID 91115929
7-[(1R,2R,3R,5S)-3,5-bis(oxan-2-yloxy)-2-[(3S)-3-(oxan-2-yloxy)-5-phenylpent-1-enyl]cyclopentyl]-N-ethylhept-5-enamide (PubChem CID 91115929) has the molecular formula C40H61NO7 and a molecular weight of 667.93 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-3,5-bis(oxan-2-yloxy)-2-[(3S)-3-(oxan-2-yloxy)-5-phenylpent-1-enyl]cyclopentyl]-N-ethylhept-5-enamide.
| Compound Name | 7-[(1R,2R,3R,5S)-3,5-bis(oxan-2-yloxy)-2-[(3S)-3-(oxan-2-yloxy)-5-phenylpent-1-enyl]cyclopentyl]-N-ethylhept-5-enamide |
|---|---|
| PubChem CID | 91115929 |
| Molecular Formula | C40H61NO7 |
| Molecular Weight | 667.93 g/mol |
| Exact Mass | 667.44 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-3,5-bis(oxan-2-yloxy)-2-[(3S)-3-(oxan-2-yloxy)-5-phenylpent-1-enyl]cyclopentyl]-N-ethylhept-5-enamide |
| SMILES | CCNC(=O)CCCC=CC[C@@H]1[C@@H](C=C[C@H](CCc2ccccc2)OC2CCCCO2)[C@H](OC2CCCCO2)C[C@@H]1OC1CCCCO1 |
| InChI | InChI=1S/C40H61NO7/c1-2-41-37(42)19-9-4-3-8-18-33-34(26-25-32(46-38-20-10-13-27-43-38)24-23-31-16-6-5-7-17-31)36(48-40-22-12-15-29-45-40)30-35(33)47-39-21-11-14-28-44-39/h3,5-8,16-17,25-26,32-36,38-40H,2,4,9-15,18-24,27-30H2,1H3,(H,41,42)/t32-,33+,34+,35-,36+,38?,39?,40?/m0/s1 |
| InChIKey | ZSYUUGFJFPSYKD-FXUUJKJGSA-N |
| XLogP | 7.80 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.93 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|