C31H48O7 — CID 70548451
methyl (Z)-7-[(1R,2R,3R,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-en-6-ynyl]cyclopentyl]hept-5-enoate (PubChem CID 70548451) has the molecular formula C31H48O7 and a molecular weight of 532.72 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2R,3R,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-en-6-ynyl]cyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2R,3R,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-en-6-ynyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 70548451 |
| Molecular Formula | C31H48O7 |
| Molecular Weight | 532.72 g/mol |
| Exact Mass | 532.34 |
| IUPAC Name | methyl (Z)-7-[(1R,2R,3R,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-en-6-ynyl]cyclopentyl]hept-5-enoate |
| SMILES | CC#CCC[C@@H](/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)OC)[C@@H](O)C[C@H]1OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C31H48O7/c1-3-4-7-14-24(37-30-17-10-12-21-35-30)19-20-26-25(15-8-5-6-9-16-29(33)34-2)27(32)23-28(26)38-31-18-11-13-22-36-31/h5,8,19-20,24-28,30-32H,6-7,9-18,21-23H2,1-2H3/b8-5-,20-19+/t24-,25+,26+,27-,28+,30?,31?/m0/s1 |
| InChIKey | RYNYPXMDPHNXJG-IQGKLULKSA-N |
| XLogP | 5.46 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.72 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|