C33H48O7 — CID 70960097
(Z)-7-[(1R,2R,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-[(E,3S)-3-(oxan-2-yloxy)-5-phenylpent-1-enyl]cyclopentyl]hept-5-enoic acid (PubChem CID 70960097) has the molecular formula C33H48O7 and a molecular weight of 556.74 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-[(E,3S)-3-(oxan-2-yloxy)-5-phenylpent-1-enyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-[(E,3S)-3-(oxan-2-yloxy)-5-phenylpent-1-enyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70960097 |
| Molecular Formula | C33H48O7 |
| Molecular Weight | 556.74 g/mol |
| Exact Mass | 556.34 |
| IUPAC Name | (Z)-7-[(1R,2R,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-[(E,3S)-3-(oxan-2-yloxy)-5-phenylpent-1-enyl]cyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@H]1[C@@H](O)CC(OC2CCCCO2)[C@@H]1/C=C/[C@H](CCc1ccccc1)OC1CCCCO1 |
| InChI | InChI=1S/C33H48O7/c34-29-24-30(40-33-17-9-11-23-38-33)28(27(29)14-6-1-2-7-15-31(35)36)21-20-26(39-32-16-8-10-22-37-32)19-18-25-12-4-3-5-13-25/h1,3-6,12-13,20-21,26-30,32-34H,2,7-11,14-19,22-24H2,(H,35,36)/b6-1-,21-20+/t26-,27+,28+,29-,30?,32?,33?/m0/s1 |
| InChIKey | GSMQYVMLTRJFLE-TZPQQVBESA-N |
| XLogP | 6.20 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.74 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|