C32H46O8 — CID 67859580
(Z)-7-[(1R,2R,3R,5R)-5-hydroxy-3-(oxan-2-yloxy)-2-[(E,3R)-3-(oxan-2-yloxy)-4-phenoxybut-1-enyl]cyclopentyl]hept-5-enoic acid (PubChem CID 67859580) has the molecular formula C32H46O8 and a molecular weight of 558.71 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,5R)-5-hydroxy-3-(oxan-2-yloxy)-2-[(E,3R)-3-(oxan-2-yloxy)-4-phenoxybut-1-enyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R,5R)-5-hydroxy-3-(oxan-2-yloxy)-2-[(E,3R)-3-(oxan-2-yloxy)-4-phenoxybut-1-enyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 67859580 |
| Molecular Formula | C32H46O8 |
| Molecular Weight | 558.71 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,5R)-5-hydroxy-3-(oxan-2-yloxy)-2-[(E,3R)-3-(oxan-2-yloxy)-4-phenoxybut-1-enyl]cyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@@H]1[C@@H](/C=C/[C@H](COc2ccccc2)OC2CCCCO2)[C@H](OC2CCCCO2)C[C@H]1O |
| InChI | InChI=1S/C32H46O8/c33-28-22-29(40-32-17-9-11-21-37-32)27(26(28)14-6-1-2-7-15-30(34)35)19-18-25(39-31-16-8-10-20-36-31)23-38-24-12-4-3-5-13-24/h1,3-6,12-13,18-19,25-29,31-33H,2,7-11,14-17,20-23H2,(H,34,35)/b6-1-,19-18+/t25-,26-,27-,28-,29-,31?,32?/m1/s1 |
| InChIKey | MABUXZGTMGHADT-KDYVFCASSA-N |
| XLogP | 5.64 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.71 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|