C33H42O8 — CID 70619477
(Z)-7-[(1R,2R,3R,5S)-5-hydroxy-2-[(E)-2-[2-(naphthalen-2-yloxymethyl)-1,3-dioxolan-2-yl]ethenyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid (PubChem CID 70619477) has the molecular formula C33H42O8 and a molecular weight of 566.69 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,5S)-5-hydroxy-2-[(E)-2-[2-(naphthalen-2-yloxymethyl)-1,3-dioxolan-2-yl]ethenyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R,5S)-5-hydroxy-2-[(E)-2-[2-(naphthalen-2-yloxymethyl)-1,3-dioxolan-2-yl]ethenyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70619477 |
| Molecular Formula | C33H42O8 |
| Molecular Weight | 566.69 g/mol |
| Exact Mass | 566.29 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,5S)-5-hydroxy-2-[(E)-2-[2-(naphthalen-2-yloxymethyl)-1,3-dioxolan-2-yl]ethenyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@@H]1[C@@H](/C=C/C2(COc3ccc4ccccc4c3)OCCO2)[C@H](OC2CCCCO2)C[C@@H]1O |
| InChI | InChI=1S/C33H42O8/c34-29-22-30(41-32-13-7-8-18-37-32)28(27(29)11-3-1-2-4-12-31(35)36)16-17-33(39-19-20-40-33)23-38-26-15-14-24-9-5-6-10-25(24)21-26/h1,3,5-6,9-10,14-17,21,27-30,32,34H,2,4,7-8,11-13,18-20,22-23H2,(H,35,36)/b3-1-,17-16+/t27-,28-,29+,30-,32?/m1/s1 |
| InChIKey | KNYQLRCVZPQCCW-DWOWCXIUSA-N |
| XLogP | 5.63 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.69 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|