C32H45F3O9 — CID 70389670
7-[5-hydroxy-3-(oxan-2-yloxy)-2-[2-(oxan-2-yloxy)-3-[3-(trifluoromethyl)phenoxy]propoxy]cyclopentyl]hept-5-enoic acid (PubChem CID 70389670) has the molecular formula C32H45F3O9 and a molecular weight of 630.70 g/mol. Its IUPAC name is 7-[5-hydroxy-3-(oxan-2-yloxy)-2-[2-(oxan-2-yloxy)-3-[3-(trifluoromethyl)phenoxy]propoxy]cyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[5-hydroxy-3-(oxan-2-yloxy)-2-[2-(oxan-2-yloxy)-3-[3-(trifluoromethyl)phenoxy]propoxy]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70389670 |
| Molecular Formula | C32H45F3O9 |
| Molecular Weight | 630.70 g/mol |
| Exact Mass | 630.30 |
| IUPAC Name | 7-[5-hydroxy-3-(oxan-2-yloxy)-2-[2-(oxan-2-yloxy)-3-[3-(trifluoromethyl)phenoxy]propoxy]cyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CCC1C(O)CC(OC2CCCCO2)C1OCC(COc1cccc(C(F)(F)F)c1)OC1CCCCO1 |
| InChI | InChI=1S/C32H45F3O9/c33-32(34,35)22-10-9-11-23(18-22)41-20-24(43-29-14-5-7-16-39-29)21-42-31-25(12-3-1-2-4-13-28(37)38)26(36)19-27(31)44-30-15-6-8-17-40-30/h1,3,9-11,18,24-27,29-31,36H,2,4-8,12-17,19-21H2,(H,37,38) |
| InChIKey | WVDWTJIJNFFFFK-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.70 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|