C31H44O10 — CID 70389985
6-hydroxy-7-[5-hydroxy-3-(oxan-2-yloxy)-2-[2-(oxan-2-yloxy)-3-phenoxypropoxy]cyclopentyl]hept-4-ynoic acid (PubChem CID 70389985) has the molecular formula C31H44O10 and a molecular weight of 576.68 g/mol. Its IUPAC name is 6-hydroxy-7-[5-hydroxy-3-(oxan-2-yloxy)-2-[2-(oxan-2-yloxy)-3-phenoxypropoxy]cyclopentyl]hept-4-ynoic acid.
| Compound Name | 6-hydroxy-7-[5-hydroxy-3-(oxan-2-yloxy)-2-[2-(oxan-2-yloxy)-3-phenoxypropoxy]cyclopentyl]hept-4-ynoic acid |
|---|---|
| PubChem CID | 70389985 |
| Molecular Formula | C31H44O10 |
| Molecular Weight | 576.68 g/mol |
| Exact Mass | 576.29 |
| IUPAC Name | 6-hydroxy-7-[5-hydroxy-3-(oxan-2-yloxy)-2-[2-(oxan-2-yloxy)-3-phenoxypropoxy]cyclopentyl]hept-4-ynoic acid |
| SMILES | O=C(O)CCC#CC(O)CC1C(O)CC(OC2CCCCO2)C1OCC(COc1ccccc1)OC1CCCCO1 |
| InChI | InChI=1S/C31H44O10/c32-22(10-4-5-13-28(34)35)18-25-26(33)19-27(41-30-15-7-9-17-37-30)31(25)39-21-24(40-29-14-6-8-16-36-29)20-38-23-11-2-1-3-12-23/h1-3,11-12,22,24-27,29-33H,5-9,13-21H2,(H,34,35) |
| InChIKey | XWUBPPIFNZOHJT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 133.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.68 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|