C33H56O7Si — CID 18636765
7-[(1R,2R,5S)-2-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-phenoxybutyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]heptanoic acid (PubChem CID 18636765) has the molecular formula C33H56O7Si and a molecular weight of 592.89 g/mol. Its IUPAC name is 7-[(1R,2R,5S)-2-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-phenoxybutyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,5S)-2-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-phenoxybutyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 18636765 |
| Molecular Formula | C33H56O7Si |
| Molecular Weight | 592.89 g/mol |
| Exact Mass | 592.38 |
| IUPAC Name | 7-[(1R,2R,5S)-2-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-phenoxybutyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]heptanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](CC[C@H]1C(OC2CCCCO2)C[C@H](O)[C@@H]1CCCCCCC(=O)O)COc1ccccc1 |
| InChI | InChI=1S/C33H56O7Si/c1-33(2,3)41(4,5)40-26(24-38-25-15-9-8-10-16-25)20-21-28-27(17-11-6-7-12-18-31(35)36)29(34)23-30(28)39-32-19-13-14-22-37-32/h8-10,15-16,26-30,32,34H,6-7,11-14,17-24H2,1-5H3,(H,35,36)/t26-,27-,28-,29+,30?,32?/m1/s1 |
| InChIKey | KMCRLBWHQHXPRS-UNMAVSLFSA-N |
| XLogP | 7.57 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.89 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|