C30H46O9S — CID 70381325
3-[3-[5-hydroxy-3-(oxan-2-yloxy)-2-[2-(oxan-2-yloxy)-3-phenoxypropoxy]cyclopentyl]propylsulfanyl]propanoic acid (PubChem CID 70381325) has the molecular formula C30H46O9S and a molecular weight of 582.76 g/mol. Its IUPAC name is 3-[3-[5-hydroxy-3-(oxan-2-yloxy)-2-[2-(oxan-2-yloxy)-3-phenoxypropoxy]cyclopentyl]propylsulfanyl]propanoic acid.
| Compound Name | 3-[3-[5-hydroxy-3-(oxan-2-yloxy)-2-[2-(oxan-2-yloxy)-3-phenoxypropoxy]cyclopentyl]propylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 70381325 |
| Molecular Formula | C30H46O9S |
| Molecular Weight | 582.76 g/mol |
| Exact Mass | 582.29 |
| IUPAC Name | 3-[3-[5-hydroxy-3-(oxan-2-yloxy)-2-[2-(oxan-2-yloxy)-3-phenoxypropoxy]cyclopentyl]propylsulfanyl]propanoic acid |
| SMILES | O=C(O)CCSCCCC1C(O)CC(OC2CCCCO2)C1OCC(COc1ccccc1)OC1CCCCO1 |
| InChI | InChI=1S/C30H46O9S/c31-25-19-26(39-29-13-5-7-16-35-29)30(24(25)11-8-17-40-18-14-27(32)33)37-21-23(38-28-12-4-6-15-34-28)20-36-22-9-2-1-3-10-22/h1-3,9-10,23-26,28-31H,4-8,11-21H2,(H,32,33) |
| InChIKey | CMWGQCCHHQQYNA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.76 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|