C44H55NO10 — CID 70391732
(4-benzamidophenyl) (Z)-7-[(1S,2S,3S,5R)-5-hydroxy-3-(oxan-2-yloxy)-2-[2-(oxan-2-yloxy)-3-phenoxypropoxy]cyclopentyl]hept-4-enoate (PubChem CID 70391732) has the molecular formula C44H55NO10 and a molecular weight of 757.92 g/mol. Its IUPAC name is (4-benzamidophenyl) (Z)-7-[(1S,2S,3S,5R)-5-hydroxy-3-(oxan-2-yloxy)-2-[2-(oxan-2-yloxy)-3-phenoxypropoxy]cyclopentyl]hept-4-enoate.
| Compound Name | (4-benzamidophenyl) (Z)-7-[(1S,2S,3S,5R)-5-hydroxy-3-(oxan-2-yloxy)-2-[2-(oxan-2-yloxy)-3-phenoxypropoxy]cyclopentyl]hept-4-enoate |
|---|---|
| PubChem CID | 70391732 |
| Molecular Formula | C44H55NO10 |
| Molecular Weight | 757.92 g/mol |
| Exact Mass | 757.38 |
| IUPAC Name | (4-benzamidophenyl) (Z)-7-[(1S,2S,3S,5R)-5-hydroxy-3-(oxan-2-yloxy)-2-[2-(oxan-2-yloxy)-3-phenoxypropoxy]cyclopentyl]hept-4-enoate |
| SMILES | O=C(CC/C=C\CC[C@@H]1[C@H](OCC(COc2ccccc2)OC2CCCCO2)[C@@H](OC2CCCCO2)C[C@H]1O)Oc1ccc(NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C44H55NO10/c46-38-29-39(55-42-22-12-14-28-50-42)43(52-31-36(54-41-21-11-13-27-49-41)30-51-34-17-7-4-8-18-34)37(38)19-9-1-2-10-20-40(47)53-35-25-23-33(24-26-35)45-44(48)32-15-5-3-6-16-32/h1-8,15-18,23-26,36-39,41-43,46H,9-14,19-22,27-31H2,(H,45,48)/b2-1-/t36?,37-,38+,39-,41?,42?,43-/m0/s1 |
| InChIKey | HNALCZCGXWVMRM-RIWBPDQISA-N |
| XLogP | 7.63 |
| TPSA | 131.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.92 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|