C38H51FO10 — CID 70391236
(4-methoxyphenyl) (Z)-7-[(1S,2R,3R,5S)-2-[3-(4-fluorophenoxy)-2-(oxan-2-yloxy)propoxy]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate (PubChem CID 70391236) has the molecular formula C38H51FO10 and a molecular weight of 686.81 g/mol. Its IUPAC name is (4-methoxyphenyl) (Z)-7-[(1S,2R,3R,5S)-2-[3-(4-fluorophenoxy)-2-(oxan-2-yloxy)propoxy]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate.
| Compound Name | (4-methoxyphenyl) (Z)-7-[(1S,2R,3R,5S)-2-[3-(4-fluorophenoxy)-2-(oxan-2-yloxy)propoxy]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 70391236 |
| Molecular Formula | C38H51FO10 |
| Molecular Weight | 686.81 g/mol |
| Exact Mass | 686.35 |
| IUPAC Name | (4-methoxyphenyl) (Z)-7-[(1S,2R,3R,5S)-2-[3-(4-fluorophenoxy)-2-(oxan-2-yloxy)propoxy]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
| SMILES | COc1ccc(OC(=O)CCC/C=C\C[C@@H]2[C@@H](OCC(COc3ccc(F)cc3)OC3CCCCO3)[C@H](OC3CCCCO3)C[C@@H]2O)cc1 |
| InChI | InChI=1S/C38H51FO10/c1-42-28-18-20-30(21-19-28)47-35(41)11-5-3-2-4-10-32-33(40)24-34(49-37-13-7-9-23-44-37)38(32)46-26-31(48-36-12-6-8-22-43-36)25-45-29-16-14-27(39)15-17-29/h2,4,14-21,31-34,36-38,40H,3,5-13,22-26H2,1H3/b4-2-/t31?,32-,33-,34+,36?,37?,38+/m0/s1 |
| InChIKey | TZWPXZPFYIAMGE-WGBJJEAUSA-N |
| XLogP | 6.52 |
| TPSA | 111.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.81 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|