C33H48O9 — CID 70390232
9-[3-(oxan-2-yloxy)-2-[2-(oxan-2-yloxy)-3-phenoxypropoxy]-5-oxocyclopentyl]non-7-enoic acid (PubChem CID 70390232) has the molecular formula C33H48O9 and a molecular weight of 588.74 g/mol. Its IUPAC name is 9-[3-(oxan-2-yloxy)-2-[2-(oxan-2-yloxy)-3-phenoxypropoxy]-5-oxocyclopentyl]non-7-enoic acid.
| Compound Name | 9-[3-(oxan-2-yloxy)-2-[2-(oxan-2-yloxy)-3-phenoxypropoxy]-5-oxocyclopentyl]non-7-enoic acid |
|---|---|
| PubChem CID | 70390232 |
| Molecular Formula | C33H48O9 |
| Molecular Weight | 588.74 g/mol |
| Exact Mass | 588.33 |
| IUPAC Name | 9-[3-(oxan-2-yloxy)-2-[2-(oxan-2-yloxy)-3-phenoxypropoxy]-5-oxocyclopentyl]non-7-enoic acid |
| SMILES | O=C(O)CCCCCC=CCC1C(=O)CC(OC2CCCCO2)C1OCC(COc1ccccc1)OC1CCCCO1 |
| InChI | InChI=1S/C33H48O9/c34-28-22-29(42-32-19-11-13-21-38-32)33(27(28)16-8-3-1-2-4-9-17-30(35)36)40-24-26(41-31-18-10-12-20-37-31)23-39-25-14-6-5-7-15-25/h3,5-8,14-15,26-27,29,31-33H,1-2,4,9-13,16-24H2,(H,35,36) |
| InChIKey | BOROKZJSKKGMEW-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.74 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|