C31H48O9 — CID 70390140
7-[5-hydroxy-3-(oxan-2-yloxy)-2-[2-(oxan-2-yloxy)-3-phenoxypropoxy]cyclopentyl]heptanoic acid (PubChem CID 70390140) has the molecular formula C31H48O9 and a molecular weight of 564.72 g/mol. Its IUPAC name is 7-[5-hydroxy-3-(oxan-2-yloxy)-2-[2-(oxan-2-yloxy)-3-phenoxypropoxy]cyclopentyl]heptanoic acid.
| Compound Name | 7-[5-hydroxy-3-(oxan-2-yloxy)-2-[2-(oxan-2-yloxy)-3-phenoxypropoxy]cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 70390140 |
| Molecular Formula | C31H48O9 |
| Molecular Weight | 564.72 g/mol |
| Exact Mass | 564.33 |
| IUPAC Name | 7-[5-hydroxy-3-(oxan-2-yloxy)-2-[2-(oxan-2-yloxy)-3-phenoxypropoxy]cyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCCC1C(O)CC(OC2CCCCO2)C1OCC(COc1ccccc1)OC1CCCCO1 |
| InChI | InChI=1S/C31H48O9/c32-26-20-27(40-30-17-9-11-19-36-30)31(25(26)14-6-1-2-7-15-28(33)34)38-22-24(39-29-16-8-10-18-35-29)21-37-23-12-4-3-5-13-23/h3-5,12-13,24-27,29-32H,1-2,6-11,14-22H2,(H,33,34) |
| InChIKey | IGLAWAURLLWGLP-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.72 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|