C26H38O8 — CID 70389974
(2R,3aR,4S,5S,6aR)-5-(oxan-2-yloxy)-4-[2-(oxan-2-yloxy)-3-phenoxypropoxy]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol (PubChem CID 70389974) has the molecular formula C26H38O8 and a molecular weight of 478.58 g/mol. Its IUPAC name is (2R,3aR,4S,5S,6aR)-5-(oxan-2-yloxy)-4-[2-(oxan-2-yloxy)-3-phenoxypropoxy]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol.
| Compound Name | (2R,3aR,4S,5S,6aR)-5-(oxan-2-yloxy)-4-[2-(oxan-2-yloxy)-3-phenoxypropoxy]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
|---|---|
| PubChem CID | 70389974 |
| Molecular Formula | C26H38O8 |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | (2R,3aR,4S,5S,6aR)-5-(oxan-2-yloxy)-4-[2-(oxan-2-yloxy)-3-phenoxypropoxy]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
| SMILES | O[C@H]1C[C@H]2[C@H](OCC(COc3ccccc3)OC3CCCCO3)[C@@H](OC3CCCCO3)C[C@H]2O1 |
| InChI | InChI=1S/C26H38O8/c27-23-14-20-21(33-23)15-22(34-25-11-5-7-13-29-25)26(20)31-17-19(32-24-10-4-6-12-28-24)16-30-18-8-2-1-3-9-18/h1-3,8-9,19-27H,4-7,10-17H2/t19?,20-,21-,22+,23-,24?,25?,26+/m1/s1 |
| InChIKey | IEOLUFPMJUVURT-PREYKKTESA-N |
| XLogP | 3.40 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |