C30H44O7 — CID 68746538
[(3R,5aR,6R,7R,8aS)-7-(oxan-2-yloxy)-6-[(3R)-3-(oxan-2-yloxy)-4-phenoxybut-1-enyl]-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]methanol (PubChem CID 68746538) has the molecular formula C30H44O7 and a molecular weight of 516.68 g/mol. Its IUPAC name is [(3R,5aR,6R,7R,8aS)-7-(oxan-2-yloxy)-6-[(3R)-3-(oxan-2-yloxy)-4-phenoxybut-1-enyl]-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]methanol.
| Compound Name | [(3R,5aR,6R,7R,8aS)-7-(oxan-2-yloxy)-6-[(3R)-3-(oxan-2-yloxy)-4-phenoxybut-1-enyl]-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]methanol |
|---|---|
| PubChem CID | 68746538 |
| Molecular Formula | C30H44O7 |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | [(3R,5aR,6R,7R,8aS)-7-(oxan-2-yloxy)-6-[(3R)-3-(oxan-2-yloxy)-4-phenoxybut-1-enyl]-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]methanol |
| SMILES | OC[C@H]1CC[C@@H]2[C@@H](C=C[C@H](COc3ccccc3)OC3CCCCO3)[C@H](OC3CCCCO3)C[C@@H]2OC1 |
| InChI | InChI=1S/C30H44O7/c31-19-22-12-14-25-26(28(18-27(25)35-20-22)37-30-11-5-7-17-33-30)15-13-24(36-29-10-4-6-16-32-29)21-34-23-8-2-1-3-9-23/h1-3,8-9,13,15,22,24-31H,4-7,10-12,14,16-21H2/t22-,24-,25-,26-,27+,28-,29?,30?/m1/s1 |
| InChIKey | FEXRVOULUXRDHC-NUFFZBMHSA-N |
| XLogP | 4.87 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|