C31H46O7 — CID 68748280
2-[2-[(3S,5aR,6R,7R,8aS)-6-[(E,3R)-3-hydroxy-4-phenoxybut-1-enyl]-7-(oxan-2-yloxy)-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]ethyl]pentanoic acid (PubChem CID 68748280) has the molecular formula C31H46O7 and a molecular weight of 530.70 g/mol. Its IUPAC name is 2-[2-[(3S,5aR,6R,7R,8aS)-6-[(E,3R)-3-hydroxy-4-phenoxybut-1-enyl]-7-(oxan-2-yloxy)-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]ethyl]pentanoic acid.
| Compound Name | 2-[2-[(3S,5aR,6R,7R,8aS)-6-[(E,3R)-3-hydroxy-4-phenoxybut-1-enyl]-7-(oxan-2-yloxy)-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]ethyl]pentanoic acid |
|---|---|
| PubChem CID | 68748280 |
| Molecular Formula | C31H46O7 |
| Molecular Weight | 530.70 g/mol |
| Exact Mass | 530.32 |
| IUPAC Name | 2-[2-[(3S,5aR,6R,7R,8aS)-6-[(E,3R)-3-hydroxy-4-phenoxybut-1-enyl]-7-(oxan-2-yloxy)-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]ethyl]pentanoic acid |
| SMILES | CCCC(CC[C@@H]1CC[C@@H]2[C@@H](/C=C/[C@@H](O)COc3ccccc3)[C@H](OC3CCCCO3)C[C@@H]2OC1)C(=O)O |
| InChI | InChI=1S/C31H46O7/c1-2-8-23(31(33)34)14-12-22-13-16-26-27(17-15-24(32)21-36-25-9-4-3-5-10-25)29(19-28(26)37-20-22)38-30-11-6-7-18-35-30/h3-5,9-10,15,17,22-24,26-30,32H,2,6-8,11-14,16,18-21H2,1H3,(H,33,34)/b17-15+/t22-,23?,24-,26-,27-,28+,29-,30?/m1/s1 |
| InChIKey | ZYGGSEVRJNOJON-CCZLCJOFSA-N |
| XLogP | 5.61 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.70 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|