C26H37ClO6 — CID 68749430
2-[2-[(3S,5aR,6R,7R,8aS)-6-[(E,3R)-4-(4-chlorophenoxy)-3-hydroxybut-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]ethyl]pentanoic acid (PubChem CID 68749430) has the molecular formula C26H37ClO6 and a molecular weight of 481.03 g/mol. Its IUPAC name is 2-[2-[(3S,5aR,6R,7R,8aS)-6-[(E,3R)-4-(4-chlorophenoxy)-3-hydroxybut-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]ethyl]pentanoic acid.
| Compound Name | 2-[2-[(3S,5aR,6R,7R,8aS)-6-[(E,3R)-4-(4-chlorophenoxy)-3-hydroxybut-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]ethyl]pentanoic acid |
|---|---|
| PubChem CID | 68749430 |
| Molecular Formula | C26H37ClO6 |
| Molecular Weight | 481.03 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | 2-[2-[(3S,5aR,6R,7R,8aS)-6-[(E,3R)-4-(4-chlorophenoxy)-3-hydroxybut-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]ethyl]pentanoic acid |
| SMILES | CCCC(CC[C@@H]1CC[C@@H]2[C@@H](/C=C/[C@@H](O)COc3ccc(Cl)cc3)[C@H](O)C[C@@H]2OC1)C(=O)O |
| InChI | InChI=1S/C26H37ClO6/c1-2-3-18(26(30)31)6-4-17-5-12-23-22(24(29)14-25(23)33-15-17)13-9-20(28)16-32-21-10-7-19(27)8-11-21/h7-11,13,17-18,20,22-25,28-29H,2-6,12,14-16H2,1H3,(H,30,31)/b13-9+/t17-,18?,20-,22-,23-,24-,25+/m1/s1 |
| InChIKey | DYPFVBMQJKLAHG-ACRGLXSXSA-N |
| XLogP | 4.71 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.03 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|