C26H36F2O6 — CID 68753721
2-[2-[(3S,5aR,6R,7R,8aS)-6-[(E,3R)-4-(3,4-difluorophenoxy)-3-hydroxybut-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]ethyl]pentanoic acid (PubChem CID 68753721) has the molecular formula C26H36F2O6 and a molecular weight of 482.56 g/mol. Its IUPAC name is 2-[2-[(3S,5aR,6R,7R,8aS)-6-[(E,3R)-4-(3,4-difluorophenoxy)-3-hydroxybut-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]ethyl]pentanoic acid.
| Compound Name | 2-[2-[(3S,5aR,6R,7R,8aS)-6-[(E,3R)-4-(3,4-difluorophenoxy)-3-hydroxybut-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]ethyl]pentanoic acid |
|---|---|
| PubChem CID | 68753721 |
| Molecular Formula | C26H36F2O6 |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | 2-[2-[(3S,5aR,6R,7R,8aS)-6-[(E,3R)-4-(3,4-difluorophenoxy)-3-hydroxybut-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]ethyl]pentanoic acid |
| SMILES | CCCC(CC[C@@H]1CC[C@@H]2[C@@H](/C=C/[C@@H](O)COc3ccc(F)c(F)c3)[C@H](O)C[C@@H]2OC1)C(=O)O |
| InChI | InChI=1S/C26H36F2O6/c1-2-3-17(26(31)32)6-4-16-5-9-21-20(24(30)13-25(21)34-14-16)10-7-18(29)15-33-19-8-11-22(27)23(28)12-19/h7-8,10-12,16-18,20-21,24-25,29-30H,2-6,9,13-15H2,1H3,(H,31,32)/b10-7+/t16-,17?,18-,20-,21-,24-,25+/m1/s1 |
| InChIKey | PXWINRAMRWZYLC-ISDWBLRGSA-N |
| XLogP | 4.33 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|