C26H44O6 — CID 68747723
2-[2-[(3S,5aR,6R,7R,8aS)-6-[(3R)-4-cyclohexyloxy-3-hydroxybut-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]ethyl]pentanoic acid (PubChem CID 68747723) has the molecular formula C26H44O6 and a molecular weight of 452.63 g/mol. Its IUPAC name is 2-[2-[(3S,5aR,6R,7R,8aS)-6-[(3R)-4-cyclohexyloxy-3-hydroxybut-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]ethyl]pentanoic acid.
| Compound Name | 2-[2-[(3S,5aR,6R,7R,8aS)-6-[(3R)-4-cyclohexyloxy-3-hydroxybut-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]ethyl]pentanoic acid |
|---|---|
| PubChem CID | 68747723 |
| Molecular Formula | C26H44O6 |
| Molecular Weight | 452.63 g/mol |
| Exact Mass | 452.31 |
| IUPAC Name | 2-[2-[(3S,5aR,6R,7R,8aS)-6-[(3R)-4-cyclohexyloxy-3-hydroxybut-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]ethyl]pentanoic acid |
| SMILES | CCCC(CC[C@@H]1CC[C@@H]2[C@@H](C=C[C@@H](O)COC3CCCCC3)[C@H](O)C[C@@H]2OC1)C(=O)O |
| InChI | InChI=1S/C26H44O6/c1-2-6-19(26(29)30)11-9-18-10-13-23-22(24(28)15-25(23)32-16-18)14-12-20(27)17-31-21-7-4-3-5-8-21/h12,14,18-25,27-28H,2-11,13,15-17H2,1H3,(H,29,30)/t18-,19?,20-,22-,23-,24-,25+/m1/s1 |
| InChIKey | JSVFAKBNUQOJOR-MNFVIUEISA-N |
| XLogP | 4.33 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.63 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|