C23H40O5 — CID 140622794
4-[(3S,5aR,6R,7R,8aS)-7-hydroxy-6-[(E,3S)-3-hydroxydec-1-enyl]-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]butanoic acid (PubChem CID 140622794) has the molecular formula C23H40O5 and a molecular weight of 396.57 g/mol. Its IUPAC name is 4-[(3S,5aR,6R,7R,8aS)-7-hydroxy-6-[(E,3S)-3-hydroxydec-1-enyl]-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]butanoic acid.
| Compound Name | 4-[(3S,5aR,6R,7R,8aS)-7-hydroxy-6-[(E,3S)-3-hydroxydec-1-enyl]-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 140622794 |
| Molecular Formula | C23H40O5 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | 4-[(3S,5aR,6R,7R,8aS)-7-hydroxy-6-[(E,3S)-3-hydroxydec-1-enyl]-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]butanoic acid |
| SMILES | CCCCCCC[C@H](O)/C=C/[C@@H]1[C@H]2CC[C@H](CCCC(=O)O)CO[C@H]2C[C@H]1O |
| InChI | InChI=1S/C23H40O5/c1-2-3-4-5-6-9-18(24)12-14-19-20-13-11-17(8-7-10-23(26)27)16-28-22(20)15-21(19)25/h12,14,17-22,24-25H,2-11,13,15-16H2,1H3,(H,26,27)/b14-12+/t17-,18-,19+,20+,21+,22-/m0/s1 |
| InChIKey | VFKOQTYRMGDHDC-FXNTYJHESA-N |
| XLogP | 4.31 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|