C20H33BrO5 — CID 153483902
(5S)-5-[(2S,3aR,4R,5R,6aS)-5-hydroxy-4-[(E,3S)-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-bromopentanoic acid (PubChem CID 153483902) has the molecular formula C20H33BrO5 and a molecular weight of 433.38 g/mol. Its IUPAC name is (5S)-5-[(2S,3aR,4R,5R,6aS)-5-hydroxy-4-[(E,3S)-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-bromopentanoic acid.
| Compound Name | (5S)-5-[(2S,3aR,4R,5R,6aS)-5-hydroxy-4-[(E,3S)-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-bromopentanoic acid |
|---|---|
| PubChem CID | 153483902 |
| Molecular Formula | C20H33BrO5 |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | (5S)-5-[(2S,3aR,4R,5R,6aS)-5-hydroxy-4-[(E,3S)-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-bromopentanoic acid |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@H]2C[C@@H]([C@@H](Br)CCCC(=O)O)O[C@H]2C[C@H]1O |
| InChI | InChI=1S/C20H33BrO5/c1-2-3-4-6-13(22)9-10-14-15-11-19(26-18(15)12-17(14)23)16(21)7-5-8-20(24)25/h9-10,13-19,22-23H,2-8,11-12H2,1H3,(H,24,25)/b10-9+/t13-,14+,15+,16-,17+,18-,19-/m0/s1 |
| InChIKey | SSYCCWPRZGYVAZ-QSXTXFDWSA-N |
| XLogP | 3.66 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|