C21H35BrO4 — CID 130470948
(5S)-5-[(2S,3aR,4R,5R,6aS)-5-hydroxy-4-[(E,3S)-3-methyloct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-bromopentanoic acid (PubChem CID 130470948) has the molecular formula C21H35BrO4 and a molecular weight of 431.41 g/mol. Its IUPAC name is (5S)-5-[(2S,3aR,4R,5R,6aS)-5-hydroxy-4-[(E,3S)-3-methyloct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-bromopentanoic acid.
| Compound Name | (5S)-5-[(2S,3aR,4R,5R,6aS)-5-hydroxy-4-[(E,3S)-3-methyloct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-bromopentanoic acid |
|---|---|
| PubChem CID | 130470948 |
| Molecular Formula | C21H35BrO4 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | (5S)-5-[(2S,3aR,4R,5R,6aS)-5-hydroxy-4-[(E,3S)-3-methyloct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-bromopentanoic acid |
| SMILES | CCCCC[C@H](C)/C=C/[C@@H]1[C@H]2C[C@@H]([C@@H](Br)CCCC(=O)O)O[C@H]2C[C@H]1O |
| InChI | InChI=1S/C21H35BrO4/c1-3-4-5-7-14(2)10-11-15-16-12-20(26-19(16)13-18(15)23)17(22)8-6-9-21(24)25/h10-11,14-20,23H,3-9,12-13H2,1-2H3,(H,24,25)/b11-10+/t14-,15+,16+,17-,18+,19-,20-/m0/s1 |
| InChIKey | CZRFFRDULYDDDW-DSYOVVJXSA-N |
| XLogP | 4.93 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|