C24H42BrNO5 — CID 70593061
2-(dimethylamino)ethyl 5-[(3aR,4R,5R,6aR)-5-hydroxy-4-[(E,3S)-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-bromopentanoate (PubChem CID 70593061) has the molecular formula C24H42BrNO5 and a molecular weight of 504.51 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 5-[(3aR,4R,5R,6aR)-5-hydroxy-4-[(E,3S)-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-bromopentanoate.
| Compound Name | 2-(dimethylamino)ethyl 5-[(3aR,4R,5R,6aR)-5-hydroxy-4-[(E,3S)-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-bromopentanoate |
|---|---|
| PubChem CID | 70593061 |
| Molecular Formula | C24H42BrNO5 |
| Molecular Weight | 504.51 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | 2-(dimethylamino)ethyl 5-[(3aR,4R,5R,6aR)-5-hydroxy-4-[(E,3S)-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-bromopentanoate |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@H]2CC(C(Br)CCCC(=O)OCCN(C)C)O[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C24H42BrNO5/c1-4-5-6-8-17(27)11-12-18-19-15-23(31-22(19)16-21(18)28)20(25)9-7-10-24(29)30-14-13-26(2)3/h11-12,17-23,27-28H,4-10,13-16H2,1-3H3/b12-11+/t17-,18+,19+,20?,21+,22+,23?/m0/s1 |
| InChIKey | WAEUCOLNYDTJBP-SQZRKURCSA-N |
| XLogP | 3.68 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.51 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|