C25H43BrO6 — CID 86737035
5-hydroxypentyl 5-[(3aR,4R,5R,6aS)-5-hydroxy-4-[(E,3S)-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-bromopentanoate (PubChem CID 86737035) has the molecular formula C25H43BrO6 and a molecular weight of 519.52 g/mol. Its IUPAC name is 5-hydroxypentyl 5-[(3aR,4R,5R,6aS)-5-hydroxy-4-[(E,3S)-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-bromopentanoate.
| Compound Name | 5-hydroxypentyl 5-[(3aR,4R,5R,6aS)-5-hydroxy-4-[(E,3S)-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-bromopentanoate |
|---|---|
| PubChem CID | 86737035 |
| Molecular Formula | C25H43BrO6 |
| Molecular Weight | 519.52 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | 5-hydroxypentyl 5-[(3aR,4R,5R,6aS)-5-hydroxy-4-[(E,3S)-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-bromopentanoate |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@H]2CC(C(Br)CCCC(=O)OCCCCCO)O[C@H]2C[C@H]1O |
| InChI | InChI=1S/C25H43BrO6/c1-2-3-5-9-18(28)12-13-19-20-16-24(32-23(20)17-22(19)29)21(26)10-8-11-25(30)31-15-7-4-6-14-27/h12-13,18-24,27-29H,2-11,14-17H2,1H3/b13-12+/t18-,19+,20+,21?,22+,23-,24?/m0/s1 |
| InChIKey | ARELPBWVGDZCGJ-ZOLKMMGDSA-N |
| XLogP | 4.28 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|