C22H38O5S — CID 70528484
2-hydroxyethyl 5-[(3aR,4R,5R,6aR)-5-hydroxy-4-[(E,3S)-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]thiophen-2-yl]pentanoate (PubChem CID 70528484) has the molecular formula C22H38O5S and a molecular weight of 414.61 g/mol. Its IUPAC name is 2-hydroxyethyl 5-[(3aR,4R,5R,6aR)-5-hydroxy-4-[(E,3S)-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]thiophen-2-yl]pentanoate.
| Compound Name | 2-hydroxyethyl 5-[(3aR,4R,5R,6aR)-5-hydroxy-4-[(E,3S)-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]thiophen-2-yl]pentanoate |
|---|---|
| PubChem CID | 70528484 |
| Molecular Formula | C22H38O5S |
| Molecular Weight | 414.61 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | 2-hydroxyethyl 5-[(3aR,4R,5R,6aR)-5-hydroxy-4-[(E,3S)-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]thiophen-2-yl]pentanoate |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@H]2CC(CCCCC(=O)OCCO)S[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C22H38O5S/c1-2-3-4-7-16(24)10-11-18-19-14-17(28-21(19)15-20(18)25)8-5-6-9-22(26)27-13-12-23/h10-11,16-21,23-25H,2-9,12-15H2,1H3/b11-10+/t16-,17?,18+,19+,20+,21+/m0/s1 |
| InChIKey | NOKXRSFNWTTXQI-PYARIROQSA-N |
| XLogP | 3.45 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.61 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|