C21H36O5S — CID 70526059
methyl 5-[(3aR,4R,5R,6aR)-5-hydroxy-4-[(E,3S)-3-hydroxyoct-1-enyl]-1-oxo-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]thiophen-2-yl]pentanoate (PubChem CID 70526059) has the molecular formula C21H36O5S and a molecular weight of 400.58 g/mol. Its IUPAC name is methyl 5-[(3aR,4R,5R,6aR)-5-hydroxy-4-[(E,3S)-3-hydroxyoct-1-enyl]-1-oxo-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]thiophen-2-yl]pentanoate.
| Compound Name | methyl 5-[(3aR,4R,5R,6aR)-5-hydroxy-4-[(E,3S)-3-hydroxyoct-1-enyl]-1-oxo-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]thiophen-2-yl]pentanoate |
|---|---|
| PubChem CID | 70526059 |
| Molecular Formula | C21H36O5S |
| Molecular Weight | 400.58 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | methyl 5-[(3aR,4R,5R,6aR)-5-hydroxy-4-[(E,3S)-3-hydroxyoct-1-enyl]-1-oxo-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]thiophen-2-yl]pentanoate |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@H]2CC(CCCCC(=O)OC)S(=O)[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C21H36O5S/c1-3-4-5-8-15(22)11-12-17-18-13-16(9-6-7-10-21(24)26-2)27(25)20(18)14-19(17)23/h11-12,15-20,22-23H,3-10,13-14H2,1-2H3/b12-11+/t15-,16?,17+,18+,19+,20+,27?/m0/s1 |
| InChIKey | LOWBPKHNRCOGQY-JFZVPLDYSA-N |
| XLogP | 3.10 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.58 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|