C21H36O6 — CID 12832970
methyl 7-hydroxy-7-[3-hydroxy-2-[(E)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoate (PubChem CID 12832970) has the molecular formula C21H36O6 and a molecular weight of 384.51 g/mol. Its IUPAC name is methyl 7-hydroxy-7-[3-hydroxy-2-[(E)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoate.
| Compound Name | methyl 7-hydroxy-7-[3-hydroxy-2-[(E)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 12832970 |
| Molecular Formula | C21H36O6 |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | methyl 7-hydroxy-7-[3-hydroxy-2-[(E)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoate |
| SMILES | CCCCCC(O)/C=C/C1C(O)CC(=O)C1C(O)CCCCCC(=O)OC |
| InChI | InChI=1S/C21H36O6/c1-3-4-6-9-15(22)12-13-16-18(24)14-19(25)21(16)17(23)10-7-5-8-11-20(26)27-2/h12-13,15-18,21-24H,3-11,14H2,1-2H3/b13-12+ |
| InChIKey | YBPYMZUMQACVQM-OUKQBFOZSA-N |
| XLogP | 2.53 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|