C20H36O4S — CID 70624657
methyl 7-[4-hydroxy-3-[(E)-3-hydroxyoct-1-enyl]thiolan-2-yl]heptanoate (PubChem CID 70624657) has the molecular formula C20H36O4S and a molecular weight of 372.57 g/mol. Its IUPAC name is methyl 7-[4-hydroxy-3-[(E)-3-hydroxyoct-1-enyl]thiolan-2-yl]heptanoate.
| Compound Name | methyl 7-[4-hydroxy-3-[(E)-3-hydroxyoct-1-enyl]thiolan-2-yl]heptanoate |
|---|---|
| PubChem CID | 70624657 |
| Molecular Formula | C20H36O4S |
| Molecular Weight | 372.57 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | methyl 7-[4-hydroxy-3-[(E)-3-hydroxyoct-1-enyl]thiolan-2-yl]heptanoate |
| SMILES | CCCCCC(O)/C=C/C1C(O)CSC1CCCCCCC(=O)OC |
| InChI | InChI=1S/C20H36O4S/c1-3-4-7-10-16(21)13-14-17-18(22)15-25-19(17)11-8-5-6-9-12-20(23)24-2/h13-14,16-19,21-22H,3-12,15H2,1-2H3/b14-13+ |
| InChIKey | ISQJENQFPVQMNA-BUHFOSPRSA-N |
| XLogP | 4.09 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.57 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|