C21H37NO6 — CID 71606775
methyl 7-[(1S,5R)-3-hydroxy-5-[(E,3S)-3-hydroxyoct-1-enyl]-2-nitrocyclopentyl]heptanoate (PubChem CID 71606775) has the molecular formula C21H37NO6 and a molecular weight of 399.53 g/mol. Its IUPAC name is methyl 7-[(1S,5R)-3-hydroxy-5-[(E,3S)-3-hydroxyoct-1-enyl]-2-nitrocyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1S,5R)-3-hydroxy-5-[(E,3S)-3-hydroxyoct-1-enyl]-2-nitrocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 71606775 |
| Molecular Formula | C21H37NO6 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | methyl 7-[(1S,5R)-3-hydroxy-5-[(E,3S)-3-hydroxyoct-1-enyl]-2-nitrocyclopentyl]heptanoate |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1CC(O)C([N+](=O)[O-])[C@H]1CCCCCCC(=O)OC |
| InChI | InChI=1S/C21H37NO6/c1-3-4-7-10-17(23)14-13-16-15-19(24)21(22(26)27)18(16)11-8-5-6-9-12-20(25)28-2/h13-14,16-19,21,23-24H,3-12,15H2,1-2H3/b14-13+/t16-,17-,18-,19?,21?/m0/s1 |
| InChIKey | NYSHXNFRFOSSNA-XLQRPFSASA-N |
| XLogP | 3.64 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|