C21H37BrO5 — CID 70530690
methyl 5-[(3aR,4R,5R,6aR)-5-hydroxy-4-[(3S)-3-hydroxyoctyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-bromopentanoate (PubChem CID 70530690) has the molecular formula C21H37BrO5 and a molecular weight of 449.43 g/mol. Its IUPAC name is methyl 5-[(3aR,4R,5R,6aR)-5-hydroxy-4-[(3S)-3-hydroxyoctyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-bromopentanoate.
| Compound Name | methyl 5-[(3aR,4R,5R,6aR)-5-hydroxy-4-[(3S)-3-hydroxyoctyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-bromopentanoate |
|---|---|
| PubChem CID | 70530690 |
| Molecular Formula | C21H37BrO5 |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | methyl 5-[(3aR,4R,5R,6aR)-5-hydroxy-4-[(3S)-3-hydroxyoctyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-bromopentanoate |
| SMILES | CCCCC[C@H](O)CC[C@@H]1[C@H]2CC(C(Br)CCCC(=O)OC)O[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C21H37BrO5/c1-3-4-5-7-14(23)10-11-15-16-12-20(27-19(16)13-18(15)24)17(22)8-6-9-21(25)26-2/h14-20,23-24H,3-13H2,1-2H3/t14-,15+,16+,17?,18+,19+,20?/m0/s1 |
| InChIKey | OTFGPLLWCQDLAD-HKUIKLNSSA-N |
| XLogP | 3.97 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|