C22H41NO3 — CID 90882469
(2S,3aR,4R,5R,6aS)-2-[5-(dimethylamino)pentyl]-4-[(3S)-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-ol (PubChem CID 90882469) has the molecular formula C22H41NO3 and a molecular weight of 367.57 g/mol. Its IUPAC name is (2S,3aR,4R,5R,6aS)-2-[5-(dimethylamino)pentyl]-4-[(3S)-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-ol.
| Compound Name | (2S,3aR,4R,5R,6aS)-2-[5-(dimethylamino)pentyl]-4-[(3S)-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-ol |
|---|---|
| PubChem CID | 90882469 |
| Molecular Formula | C22H41NO3 |
| Molecular Weight | 367.57 g/mol |
| Exact Mass | 367.31 |
| IUPAC Name | (2S,3aR,4R,5R,6aS)-2-[5-(dimethylamino)pentyl]-4-[(3S)-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-ol |
| SMILES | CCCCC[C@H](O)C=C[C@@H]1[C@H]2C[C@H](CCCCCN(C)C)O[C@H]2C[C@H]1O |
| InChI | InChI=1S/C22H41NO3/c1-4-5-7-10-17(24)12-13-19-20-15-18(26-22(20)16-21(19)25)11-8-6-9-14-23(2)3/h12-13,17-22,24-25H,4-11,14-16H2,1-3H3/t17-,18-,19+,20+,21+,22-/m0/s1 |
| InChIKey | YHMQXUOSYKILMC-IBJQYKMBSA-N |
| XLogP | 3.76 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.57 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|