C22H39NO2 — CID 21039095
(2R,3R,3aS,6aS)-5-[5-(dimethylamino)pentyl]-3-[(E,3S)-3-hydroxyhept-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 21039095) has the molecular formula C22H39NO2 and a molecular weight of 349.56 g/mol. Its IUPAC name is (2R,3R,3aS,6aS)-5-[5-(dimethylamino)pentyl]-3-[(E,3S)-3-hydroxyhept-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3R,3aS,6aS)-5-[5-(dimethylamino)pentyl]-3-[(E,3S)-3-hydroxyhept-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 21039095 |
| Molecular Formula | C22H39NO2 |
| Molecular Weight | 349.56 g/mol |
| Exact Mass | 349.30 |
| IUPAC Name | (2R,3R,3aS,6aS)-5-[5-(dimethylamino)pentyl]-3-[(E,3S)-3-hydroxyhept-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | CCCC[C@H](O)/C=C/[C@@H]1[C@H]2CC(CCCCCN(C)C)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C22H39NO2/c1-4-5-10-19(24)11-12-20-21-15-17(14-18(21)16-22(20)25)9-7-6-8-13-23(2)3/h11-12,14,18-22,24-25H,4-10,13,15-16H2,1-3H3/b12-11+/t18-,19-,20+,21-,22+/m0/s1 |
| InChIKey | JIGXMLJFNMPKMP-HVNAKHRXSA-N |
| XLogP | 4.16 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.56 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|