C20H33NO3 — CID 91366837
4-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3S)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]butanamide (PubChem CID 91366837) has the molecular formula C20H33NO3 and a molecular weight of 335.49 g/mol. Its IUPAC name is 4-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3S)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]butanamide.
| Compound Name | 4-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3S)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]butanamide |
|---|---|
| PubChem CID | 91366837 |
| Molecular Formula | C20H33NO3 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.25 |
| IUPAC Name | 4-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3S)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]butanamide |
| SMILES | CCCCC[C@H](O)C=C[C@@H]1[C@H]2CC(CCCC(N)=O)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C20H33NO3/c1-2-3-4-7-16(22)9-10-17-18-12-14(6-5-8-20(21)24)11-15(18)13-19(17)23/h9-11,15-19,22-23H,2-8,12-13H2,1H3,(H2,21,24)/t15-,16-,17+,18-,19+/m0/s1 |
| InChIKey | GLLYDUOWKXRXGK-QXCZDIPSSA-N |
| XLogP | 3.08 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|