C25H43NO3 — CID 21038851
(2R,3R,3aS,6aS)-3-[(E,3R)-3-hydroxyoct-1-enyl]-5-(5-morpholin-4-ylpentyl)-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 21038851) has the molecular formula C25H43NO3 and a molecular weight of 405.62 g/mol. Its IUPAC name is (2R,3R,3aS,6aS)-3-[(E,3R)-3-hydroxyoct-1-enyl]-5-(5-morpholin-4-ylpentyl)-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3R,3aS,6aS)-3-[(E,3R)-3-hydroxyoct-1-enyl]-5-(5-morpholin-4-ylpentyl)-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 21038851 |
| Molecular Formula | C25H43NO3 |
| Molecular Weight | 405.62 g/mol |
| Exact Mass | 405.32 |
| IUPAC Name | (2R,3R,3aS,6aS)-3-[(E,3R)-3-hydroxyoct-1-enyl]-5-(5-morpholin-4-ylpentyl)-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | CCCCC[C@@H](O)/C=C/[C@@H]1[C@H]2CC(CCCCCN3CCOCC3)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C25H43NO3/c1-2-3-5-9-22(27)10-11-23-24-18-20(17-21(24)19-25(23)28)8-6-4-7-12-26-13-15-29-16-14-26/h10-11,17,21-25,27-28H,2-9,12-16,18-19H2,1H3/b11-10+/t21-,22+,23+,24-,25+/m0/s1 |
| InChIKey | FNUZPHWSXZHFSQ-ZLDPGJARSA-N |
| XLogP | 4.32 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.62 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|